ChemNet > CAS > 26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine
| Ονομασία του προϊόντος |
2-[(4-chlorophenyl)thio]-3-nitropyridine |
| Αγγλικό όνομα |
2-[(4-chlorophenyl)thio]-3-nitropyridine;2-[(4-chlorophenyl)sulfanyl]-3-nitropyridine |
| MF |
C11H7ClN2O2S |
| Μοριακό βάρος |
266.7035 |
| InChI |
InChI=1/C11H7ClN2O2S/c12-8-3-5-9(6-4-8)17-11-10(14(15)16)2-1-7-13-11/h1-7H |
| CAS ΟΧΙ |
26820-31-5 |
| Μοριακή δομή |
![26820-31-5 2-[(4-chlorophenyl)thio]-3-nitropyridine](https://images-a.chemnet.com/suppliers/chembase/cas11/cas26820-31-5.gif)
|
| Πυκνότητα |
1.47g/cm3 |
| Σημείο τήξης |
127℃ |
| Σημείο βρασμού |
398.4°C at 760 mmHg |
| Δείκτης διάθλασης |
1.68 |
| Σημείο ανάφλεξης |
194.8°C |
| Πίεση ατμών |
3.39E-06mmHg at 25°C |
| Σύμβολα επικινδυνότητας |
|
| Κινδύνου Κώδικες |
|
| Περιγραφή της ασφάλειας |
S24/25:Avoid contact with skin and eyes.;
|
|
